 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1cc2cc(n(c2cc1)C)C(=O)NC(C(=O)NC(CCSC)C(=O)[O-])C |
| InChI: | InChI=1/C18H22ClN3O4S/c1-10(16(23)21-13(18(25)26)6-7-27-3)20-17(24)15-9-11-8-12(19)4-5-14(11)22(15)2/h4-5,8-10,13H,6-7H2,1-3H3,(H,20,24)(H,21,23)(H,25,26)/p-1/t10-,13-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=46.1265 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 410.902 g/mol | logS: -4.55185 | SlogP: 1.297 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0487064 | Sterimol/B1: 2.15551 | Sterimol/B2: 2.82216 | Sterimol/B3: 4.35851 | |||
| Sterimol/B4: 9.94499 | Sterimol/L: 17.9177 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 687.925 | Positive charged surface: 347.196 | Negative charged surface: 335.143 | Volume: 367.125 | |||
| Hydrophobic surface: 485.452 | Hydrophilic surface: 202.473 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
