 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C2C(CC3C(C2)(CCCC23OC2)C)C(C[NH+]2CCN(CC2)c2cc(ccc2)C)C1=O |
| InChI: | InChI=1/C26H36N2O3/c1-18-5-3-6-19(13-18)28-11-9-27(10-12-28)16-21-20-14-23-25(2,15-22(20)31-24(21)29)7-4-8-26(23)17-30-26/h3,5-6,13,20-23H,4,7-12,14-17H2,1-2H3/p+1/t20-,21-,22-,23+,25-,26+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=124.454 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 425.593 g/mol | logS: -4.77771 | SlogP: 2.22692 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.051693 | Sterimol/B1: 2.60998 | Sterimol/B2: 3.93401 | Sterimol/B3: 5.07373 | |||
| Sterimol/B4: 6.1233 | Sterimol/L: 20.5436 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 704.317 | Positive charged surface: 510.379 | Negative charged surface: 193.938 | Volume: 436.625 | |||
| Hydrophobic surface: 610.391 | Hydrophilic surface: 93.926 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 6 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
