 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C2C(C=C3C(C2)(CCCC3C)C)C(C[NH+]2CCN(CC2)c2ccccc2)C1=O |
| InChI: | InChI=1/C25H34N2O2/c1-18-7-6-10-25(2)16-23-20(15-22(18)25)21(24(28)29-23)17-26-11-13-27(14-12-26)19-8-4-3-5-9-19/h3-5,8-9,15,18,20-21,23H,6-7,10-14,16-17H2,1-2H3/p+1/t18-,20+,21+,23+,25+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=106.4 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 395.567 g/mol | logS: -4.94741 | SlogP: 2.7057 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0451809 | Sterimol/B1: 2.30347 | Sterimol/B2: 3.46016 | Sterimol/B3: 4.01254 | |||
| Sterimol/B4: 7.49666 | Sterimol/L: 20.4332 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 675.479 | Positive charged surface: 506.546 | Negative charged surface: 168.934 | Volume: 412.75 | |||
| Hydrophobic surface: 574.482 | Hydrophilic surface: 100.997 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
