Type: Neutral
Formula: C20H25N7O6S
SMILES: |
S(=O)(=O)(NC(=O)Nc1nc(nc(ON=C2CCCCC2)n1)N(C)C)c1ccccc1C(OC)=
O |
InChI: |
InChI=1/C20H25N7O6S/c1-27(2)18-21-17(23-20(24-18)33-25-13-9-5-4-6-10-13)22-19(29)26-34(30,31)15-12-8-7-11-14(15)16(28)32-3/h7-8,11-12H,4-6,9-10H2,1-3H3,(H2,21,22,23,24,26,29) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 491.529 g/mol | logS: -5.98315 | SlogP: 1.9335 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0808966 | Sterimol/B1: 2.42487 | Sterimol/B2: 4.28483 | Sterimol/B3: 4.64762 |
Sterimol/B4: 11.9338 | Sterimol/L: 18.9283 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 802.71 | Positive charged surface: 592.031 | Negative charged surface: 210.679 | Volume: 422.375 |
Hydrophobic surface: 607.889 | Hydrophilic surface: 194.821 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |