Type: Neutral
Formula: C21H32O3
SMILES: |
O(C(=O)C)C1CCC2C3C(CCC12C)C1(C(=CC(O)CC1)CC3)C |
InChI: |
InChI=1/C21H32O3/c1-13(22)24-19-7-6-17-16-5-4-14-12-15(23)8-10-20(14,2)18(16)9-11-21(17,19)3/h12,15-19,23H,4-11H2,1-3H3/t15-,16+,17-,18+,19-,20-,21-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 332.484 g/mol | logS: -4.8681 | SlogP: 4.2418 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.111256 | Sterimol/B1: 3.01116 | Sterimol/B2: 3.49528 | Sterimol/B3: 3.90924 |
Sterimol/B4: 5.45267 | Sterimol/L: 17.0139 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 558.225 | Positive charged surface: 402.813 | Negative charged surface: 155.412 | Volume: 343.75 |
Hydrophobic surface: 435.279 | Hydrophilic surface: 122.946 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 7 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |