Type: Neutral
Formula: C13H16N2O2
SMILES: |
OC(=O)C1NC(C2Nc3c(C2C1)cccc3)C |
InChI: |
InChI=1/C13H16N2O2/c1-7-12-9(6-11(14-7)13(16)17)8-4-2-3-5-10(8)15-12/h2-5,7,9,11-12,14-15H,6H2,1H3,(H,16,17)/t7-,9+,11-,12+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 232.283 g/mol | logS: -1.68037 | SlogP: 1.3993 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.125764 | Sterimol/B1: 2.18752 | Sterimol/B2: 3.36431 | Sterimol/B3: 3.54699 |
Sterimol/B4: 7.55931 | Sterimol/L: 11.9374 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 429.955 | Positive charged surface: 284.933 | Negative charged surface: 145.022 | Volume: 222 |
Hydrophobic surface: 291.52 | Hydrophilic surface: 138.435 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |