Type: Neutral
Formula: C17H25N3O6
SMILES: |
o1cccc1C(=O)NC(C(C)C)C(OCC(=O)NC(=O)NC(C)(C)C)=O |
InChI: |
InChI=1/C17H25N3O6/c1-10(2)13(19-14(22)11-7-6-8-25-11)15(23)26-9-12(21)18-16(24)20-17(3,4)5/h6-8,10,13H,9H2,1-5H3,(H,19,22)(H2,18,20,21,24)/t13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 367.402 g/mol | logS: -3.80423 | SlogP: 1.2015 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0365813 | Sterimol/B1: 2.45217 | Sterimol/B2: 3.39106 | Sterimol/B3: 3.94611 |
Sterimol/B4: 6.8931 | Sterimol/L: 21.442 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 661.595 | Positive charged surface: 417.229 | Negative charged surface: 244.366 | Volume: 346.5 |
Hydrophobic surface: 416.257 | Hydrophilic surface: 245.338 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |