 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C(Cc2nc[nH]c2)C(=O)[O-])C(=O)C2C1C1c3c(C2c2c1cccc2)ccc c3 |
| InChI: | InChI=1/C24H19N3O4/c28-22-20-18-13-5-1-2-6-14(13)19(16-8-4-3-7-15(16)18)21(20)23(29)27(22)17(24(30)31)9-12-10-25-11-26-12/h1-8,10-11,17-21H,9H2,(H,25,26)(H,30,31)/p-1/t17-,18-,19+,20-,21+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=73.9831 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 412.425 g/mol | logS: -4.20169 | SlogP: 0.96287 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.195943 | Sterimol/B1: 2.5203 | Sterimol/B2: 4.29977 | Sterimol/B3: 4.34834 | |||
| Sterimol/B4: 9.20225 | Sterimol/L: 13.9844 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 603.127 | Positive charged surface: 359.642 | Negative charged surface: 243.485 | Volume: 371.375 | |||
| Hydrophobic surface: 440.473 | Hydrophilic surface: 162.654 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
