Type: Neutral
Formula: C20H24N2O4
SMILES: |
Oc1cc([N+](=O)[O-])ccc1NC(=O)C1C2C1CC\C=C/CC\C=C\CC2 |
InChI: |
InChI=1/C20H24N2O4/c23-18-13-14(22(25)26)11-12-17(18)21-20(24)19-15-9-7-5-3-1-2-4-6-8-10-16(15)19/h3-6,11-13,15-16,19,23H,1-2,7-10H2,(H,21,24)/b5-3-,6-4+/t15-,16-,19+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 356.422 g/mol | logS: -5.04563 | SlogP: 4.5677 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0607391 | Sterimol/B1: 2.95719 | Sterimol/B2: 4.0392 | Sterimol/B3: 4.49051 |
Sterimol/B4: 5.2552 | Sterimol/L: 18.4722 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 598.22 | Positive charged surface: 365.429 | Negative charged surface: 232.791 | Volume: 341.75 |
Hydrophobic surface: 395.527 | Hydrophilic surface: 202.693 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |