Type: Neutral
Formula: C18H27N3O3
| SMILES: |
O(CCCNC(=O)C1N(CCC1)C(=O)Nc1cc(ccc1)C)CC |
| InChI: |
InChI=1/C18H27N3O3/c1-3-24-12-6-10-19-17(22)16-9-5-11-21(16)18(23)20-15-8-4-7-14(2)13-15/h4,7-8,13,16H,3,5-6,9-12H2,1-2H3,(H,19,22)(H,20,23)/t16-/m1/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 333.432 g/mol | logS: -3.19269 | SlogP: 2.53412 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0455693 | Sterimol/B1: 3.59622 | Sterimol/B2: 3.73815 | Sterimol/B3: 4.07483 |
| Sterimol/B4: 8.38932 | Sterimol/L: 20.1864 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 664.034 | Positive charged surface: 488.438 | Negative charged surface: 175.595 | Volume: 341.5 |
| Hydrophobic surface: 570.192 | Hydrophilic surface: 93.842 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 1 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |