Type: Neutral
Formula: C17H24N4O3S
SMILES: |
S(=O)(=O)(N(CC(=O)NCCCn1ccnc1)c1cccc(C)c1C)C |
InChI: |
InChI=1/C17H24N4O3S/c1-14-6-4-7-16(15(14)2)21(25(3,23)24)12-17(22)19-8-5-10-20-11-9-18-13-20/h4,6-7,9,11,13H,5,8,10,12H2,1-3H3,(H,19,22) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 364.47 g/mol | logS: -2.59974 | SlogP: 1.73884 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0900773 | Sterimol/B1: 2.21974 | Sterimol/B2: 2.78379 | Sterimol/B3: 5.80785 |
Sterimol/B4: 8.13056 | Sterimol/L: 17.3537 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 629.673 | Positive charged surface: 421.593 | Negative charged surface: 208.08 | Volume: 346.875 |
Hydrophobic surface: 500.437 | Hydrophilic surface: 129.236 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |