Type: Neutral
Formula: C17H25N3O3
| SMILES: |
O=C(NC(Cc1ccccc1)C(=O)N)C(NC(=O)C)CC(C)C |
| InChI: |
InChI=1/C17H25N3O3/c1-11(2)9-15(19-12(3)21)17(23)20-14(16(18)22)10-13-7-5-4-6-8-13/h4-8,11,14-15H,9-10H2,1-3H3,(H2,18,22)(H,19,21)(H,20,23)/t14-,15+/m1/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 319.405 g/mol | logS: -3.61039 | SlogP: 0.74997 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.205949 | Sterimol/B1: 3.04767 | Sterimol/B2: 4.13403 | Sterimol/B3: 4.19642 |
| Sterimol/B4: 8.26401 | Sterimol/L: 12.061 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 578.441 | Positive charged surface: 365.78 | Negative charged surface: 212.661 | Volume: 320.375 |
| Hydrophobic surface: 388.273 | Hydrophilic surface: 190.168 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 2 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |