Type: Neutral
Formula: C17H24ClN3O3
SMILES: |
Clc1cc(NC(=O)N2CCCC2C(=O)NCCCOCC)ccc1 |
InChI: |
InChI=1/C17H24ClN3O3/c1-2-24-11-5-9-19-16(22)15-8-4-10-21(15)17(23)20-14-7-3-6-13(18)12-14/h3,6-7,12,15H,2,4-5,8-11H2,1H3,(H,19,22)(H,20,23)/t15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 353.85 g/mol | logS: -3.45306 | SlogP: 2.8791 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0354254 | Sterimol/B1: 3.38105 | Sterimol/B2: 3.78913 | Sterimol/B3: 5.43348 |
Sterimol/B4: 7.44725 | Sterimol/L: 18.8406 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 655.449 | Positive charged surface: 445.587 | Negative charged surface: 209.862 | Volume: 334.375 |
Hydrophobic surface: 569.027 | Hydrophilic surface: 86.422 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |