Type: Neutral
Formula: C18H19N3O3
SMILES: |
OCCCNC(=O)/C(/NC(=O)c1ccccc1)=C\c1ccncc1 |
InChI: |
InChI=1/C18H19N3O3/c22-12-4-9-20-18(24)16(13-14-7-10-19-11-8-14)21-17(23)15-5-2-1-3-6-15/h1-3,5-8,10-11,13,22H,4,9,12H2,(H,20,24)(H,21,23)/b16-13- |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 325.368 g/mol | logS: -2.78394 | SlogP: 1.3511 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0379068 | Sterimol/B1: 2.68244 | Sterimol/B2: 3.19023 | Sterimol/B3: 3.51562 |
Sterimol/B4: 9.75454 | Sterimol/L: 17.6281 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 593.069 | Positive charged surface: 394.823 | Negative charged surface: 198.246 | Volume: 313.75 |
Hydrophobic surface: 454.46 | Hydrophilic surface: 138.609 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |