Type: Neutral
Formula: C18H21F3N4O2
SMILES: |
FC(F)(F)C1n2ncc(c2NC(C1)c1ccccc1)C(=O)NC(COC)C |
InChI: |
InChI=1/C18H21F3N4O2/c1-11(10-27-2)23-17(26)13-9-22-25-15(18(19,20)21)8-14(24-16(13)25)12-6-4-3-5-7-12/h3-7,9,11,14-15,24H,8,10H2,1-2H3,(H,23,26)/t11-,14-,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 382.386 g/mol | logS: -3.64013 | SlogP: 3.919 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0585829 | Sterimol/B1: 2.28347 | Sterimol/B2: 3.44971 | Sterimol/B3: 5.01048 |
Sterimol/B4: 8.19105 | Sterimol/L: 17.1599 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 631.299 | Positive charged surface: 393.334 | Negative charged surface: 237.965 | Volume: 336.25 |
Hydrophobic surface: 464.501 | Hydrophilic surface: 166.798 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |