Type: Neutral
Formula: C14H27N3O4
SMILES: |
O(C(C)(C)C)C(=O)NC(C(CC)C)C(=O)NC(C(=O)N)C |
InChI: |
InChI=1/C14H27N3O4/c1-7-8(2)10(12(19)16-9(3)11(15)18)17-13(20)21-14(4,5)6/h8-10H,7H2,1-6H3,(H2,15,18)(H,16,19)(H,17,20)/t8-,9+,10+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 301.387 g/mol | logS: -2.84587 | SlogP: 0.9158 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.106736 | Sterimol/B1: 1.969 | Sterimol/B2: 2.48092 | Sterimol/B3: 5.58006 |
Sterimol/B4: 6.77591 | Sterimol/L: 16.2634 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 568.848 | Positive charged surface: 388.758 | Negative charged surface: 180.09 | Volume: 299.5 |
Hydrophobic surface: 304.264 | Hydrophilic surface: 264.584 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |