Type: Neutral
Formula: C20H21N3O5
SMILES: |
O(C)c1cc(ccc1OC)CC1(CCc2ccncc2)C(=O)NC(=O)NC1=O |
InChI: |
InChI=1/C20H21N3O5/c1-27-15-4-3-14(11-16(15)28-2)12-20(8-5-13-6-9-21-10-7-13)17(24)22-19(26)23-18(20)25/h3-4,6-7,9-11H,5,8,12H2,1-2H3,(H2,22,23,24,25,26) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 383.404 g/mol | logS: -3.17541 | SlogP: 1.62644 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0871474 | Sterimol/B1: 2.77586 | Sterimol/B2: 3.66152 | Sterimol/B3: 5.22127 |
Sterimol/B4: 7.23898 | Sterimol/L: 17.7451 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 605.878 | Positive charged surface: 428.256 | Negative charged surface: 177.622 | Volume: 348.625 |
Hydrophobic surface: 444.334 | Hydrophilic surface: 161.544 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |