Type: Neutral
Formula: C10H17N5O3
SMILES: |
O=C1NC2NC(=O)NC2N1CC(=O)NC(CC)C |
InChI: |
InChI=1/C10H17N5O3/c1-3-5(2)11-6(16)4-15-8-7(13-10(15)18)12-9(17)14-8/h5,7-8H,3-4H2,1-2H3,(H,11,16)(H,13,18)(H2,12,14,17)/t5-,7+,8+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 255.278 g/mol | logS: -0.60003 | SlogP: -1.1087 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0803875 | Sterimol/B1: 2.95796 | Sterimol/B2: 3.50423 | Sterimol/B3: 3.78206 |
Sterimol/B4: 5.69914 | Sterimol/L: 13.6059 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 473.897 | Positive charged surface: 333.954 | Negative charged surface: 139.943 | Volume: 231.25 |
Hydrophobic surface: 202.616 | Hydrophilic surface: 271.281 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |