Type: Neutral
Formula: C14H24N4O5
SMILES: |
O=C1NC(CC1)C(=O)NC(C(=O)NC(CC(C)C)C(=O)N)CO |
InChI: |
InChI=1/C14H24N4O5/c1-7(2)5-9(12(15)21)17-14(23)10(6-19)18-13(22)8-3-4-11(20)16-8/h7-10,19H,3-6H2,1-2H3,(H2,15,21)(H,16,20)(H,17,23)(H,18,22)/t8-,9-,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 328.369 g/mol | logS: -1.97622 | SlogP: -2.2417 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.104603 | Sterimol/B1: 2.38915 | Sterimol/B2: 2.92648 | Sterimol/B3: 5.48201 |
Sterimol/B4: 7.24075 | Sterimol/L: 16.5475 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 589.059 | Positive charged surface: 408.322 | Negative charged surface: 180.738 | Volume: 305 |
Hydrophobic surface: 283.248 | Hydrophilic surface: 305.811 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |