Type: Neutral
Formula: C15H30N6O3
SMILES: |
O=C1N(C)C(NC(=O)NC(CC)C)C(NC(=O)NC(CC)C)N1C |
InChI: |
InChI=1/C15H30N6O3/c1-7-9(3)16-13(22)18-11-12(21(6)15(24)20(11)5)19-14(23)17-10(4)8-2/h9-12H,7-8H2,1-6H3,(H2,16,18,22)(H2,17,19,23)/t9-,10-,11-,12+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 342.444 g/mol | logS: -1.04261 | SlogP: 0.8312 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0900985 | Sterimol/B1: 2.28082 | Sterimol/B2: 5.0184 | Sterimol/B3: 5.19327 |
Sterimol/B4: 8.0427 | Sterimol/L: 15.0467 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 634.353 | Positive charged surface: 482.655 | Negative charged surface: 151.698 | Volume: 343.25 |
Hydrophobic surface: 440.347 | Hydrophilic surface: 194.006 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |