Type: Neutral
Formula: C16H29N3O6
SMILES: |
O(C(C)(C)C)C(=O)CC(NC(OC(C)(C)C)=O)C(=O)NC(C(=O)N)C |
InChI: |
InChI=1/C16H29N3O6/c1-9(12(17)21)18-13(22)10(8-11(20)24-15(2,3)4)19-14(23)25-16(5,6)7/h9-10H,8H2,1-7H3,(H2,17,21)(H,18,22)(H,19,23)/t9-,10+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 359.423 g/mol | logS: -2.87162 | SlogP: 0.6015 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.111964 | Sterimol/B1: 2.28892 | Sterimol/B2: 4.53933 | Sterimol/B3: 5.11746 |
Sterimol/B4: 9.71321 | Sterimol/L: 15.1778 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 658.464 | Positive charged surface: 451.28 | Negative charged surface: 207.184 | Volume: 347 |
Hydrophobic surface: 365.813 | Hydrophilic surface: 292.651 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |