 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1NC2NC(=O)NC2N1CC(=O)NCC(O)=O |
| InChI: | InChI=1/C8H11N5O5/c14-3(9-1-4(15)16)2-13-6-5(11-8(13)18)10-7(17)12-6/h5-6H,1-2H2,(H,9,14)(H,11,18)(H,15,16)(H2,10,12,17)/t5-,6+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-10.7573 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 257.206 g/mol | logS: 0.26032 | SlogP: -2.8226 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0653022 | Sterimol/B1: 2.69198 | Sterimol/B2: 3.37758 | Sterimol/B3: 4.04757 | |||
| Sterimol/B4: 4.37001 | Sterimol/L: 14.7574 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 441.407 | Positive charged surface: 293.083 | Negative charged surface: 148.324 | Volume: 203.125 | |||
| Hydrophobic surface: 97.8479 | Hydrophilic surface: 343.5591 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
