Type: Neutral
Formula: C17H19N3O4
SMILES: |
O1CCCC1CN1C(=O)\C(=C/Nc2cc(ccc2)C)\C(=O)NC1=O |
InChI: |
InChI=1/C17H19N3O4/c1-11-4-2-5-12(8-11)18-9-14-15(21)19-17(23)20(16(14)22)10-13-6-3-7-24-13/h2,4-5,8-9,13,18H,3,6-7,10H2,1H3,(H,19,21,23)/b14-9-/t13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 329.356 g/mol | logS: -3.4637 | SlogP: 1.54822 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0437825 | Sterimol/B1: 2.34627 | Sterimol/B2: 2.88875 | Sterimol/B3: 4.21357 |
Sterimol/B4: 8.69114 | Sterimol/L: 15.6833 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 573.452 | Positive charged surface: 372.168 | Negative charged surface: 201.284 | Volume: 302.5 |
Hydrophobic surface: 434.475 | Hydrophilic surface: 138.977 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |