 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(CCNC(=O)C(NC(=O)C)Cc1c2c([nH]c1)cccc2)c1cc(ccc1C(C)C)C |
| InChI: | InChI=1/C25H31N3O3/c1-16(2)20-10-9-17(3)13-24(20)31-12-11-26-25(30)23(28-18(4)29)14-19-15-27-22-8-6-5-7-21(19)22/h5-10,13,15-16,23,27H,11-12,14H2,1-4H3,(H,26,30)(H,28,29)/t23-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=111.349 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 421.541 g/mol | logS: -5.57186 | SlogP: 3.84209 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0786521 | Sterimol/B1: 2.12941 | Sterimol/B2: 4.019 | Sterimol/B3: 6.44135 | |||
| Sterimol/B4: 6.62766 | Sterimol/L: 19.1905 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 728.629 | Positive charged surface: 479.217 | Negative charged surface: 246.455 | Volume: 424.25 | |||
| Hydrophobic surface: 578.6 | Hydrophilic surface: 150.029 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.