Type: Neutral
Formula: C17H18N2O2S2
SMILES: |
s1c2c(CCCC2)c(C(=O)NCC=C)c1NC(=O)c1sccc1 |
InChI: |
InChI=1/C17H18N2O2S2/c1-2-9-18-16(21)14-11-6-3-4-7-12(11)23-17(14)19-15(20)13-8-5-10-22-13/h2,5,8,10H,1,3-4,6-7,9H2,(H,18,21)(H,19,20) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 346.475 g/mol | logS: -4.85772 | SlogP: 3.85644 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0509269 | Sterimol/B1: 2.15681 | Sterimol/B2: 2.33031 | Sterimol/B3: 4.58844 |
Sterimol/B4: 11.0257 | Sterimol/L: 15.6779 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 598.854 | Positive charged surface: 335.66 | Negative charged surface: 263.194 | Volume: 317.75 |
Hydrophobic surface: 468.274 | Hydrophilic surface: 130.58 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |