Type: Neutral
Formula: C16H20N4O2
SMILES: |
O=C(NC(C)c1ccccc1)C(=O)NCCCn1ccnc1 |
InChI: |
InChI=1/C16H20N4O2/c1-13(14-6-3-2-4-7-14)19-16(22)15(21)18-8-5-10-20-11-9-17-12-20/h2-4,6-7,9,11-13H,5,8,10H2,1H3,(H,18,21)(H,19,22)/t13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 300.362 g/mol | logS: -2.52513 | SlogP: 1.6287 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0448056 | Sterimol/B1: 2.11803 | Sterimol/B2: 2.41999 | Sterimol/B3: 4.74694 |
Sterimol/B4: 6.00906 | Sterimol/L: 19.4882 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 595.373 | Positive charged surface: 399.859 | Negative charged surface: 195.514 | Volume: 298.625 |
Hydrophobic surface: 444.875 | Hydrophilic surface: 150.498 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |