Type: Neutral
Formula: C16H17N3O2S3
SMILES: |
s1c2CC(CCc2c(C(=O)N)c1NC(=S)NC(=O)c1sccc1)C |
InChI: |
InChI=1/C16H17N3O2S3/c1-8-4-5-9-11(7-8)24-15(12(9)13(17)20)19-16(22)18-14(21)10-3-2-6-23-10/h2-3,6,8H,4-5,7H2,1H3,(H2,17,20)(H2,18,19,21,22)/t8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 379.529 g/mol | logS: -6.44619 | SlogP: 3.16004 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0170064 | Sterimol/B1: 2.47565 | Sterimol/B2: 2.99739 | Sterimol/B3: 3.13816 |
Sterimol/B4: 7.51409 | Sterimol/L: 18.9322 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 601.212 | Positive charged surface: 335.321 | Negative charged surface: 265.891 | Volume: 324.25 |
Hydrophobic surface: 379.721 | Hydrophilic surface: 221.491 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |