Type: Neutral
Formula: C19H21N3O
SMILES: |
O=C(NCCCCCc1[nH]c2c(n1)cccc2)c1ccccc1 |
InChI: |
InChI=1/C19H21N3O/c23-19(15-9-3-1-4-10-15)20-14-8-2-5-13-18-21-16-11-6-7-12-17(16)22-18/h1,3-4,6-7,9-12H,2,5,8,13-14H2,(H,20,23)(H,21,22) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 307.397 g/mol | logS: -4.21721 | SlogP: 3.70567 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0187832 | Sterimol/B1: 2.98383 | Sterimol/B2: 3.04131 | Sterimol/B3: 3.58166 |
Sterimol/B4: 5.56058 | Sterimol/L: 21.1425 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 617.478 | Positive charged surface: 395.143 | Negative charged surface: 222.335 | Volume: 313.5 |
Hydrophobic surface: 531.263 | Hydrophilic surface: 86.215 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |