 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1cccc1CN1C2CC(NC(=O)c3cc(OC)ccc3)CC1CCC2 |
| InChI: | InChI=1/C21H26N2O2S/c1-25-19-8-2-5-15(11-19)21(24)22-16-12-17-6-3-7-18(13-16)23(17)14-20-9-4-10-26-20/h2,4-5,8-11,16-18H,3,6-7,12-14H2,1H3,(H,22,24)/t16-,17-,18+ |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=77.2457 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 370.517 g/mol | logS: -4.36038 | SlogP: 4.3386 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0939196 | Sterimol/B1: 3.17973 | Sterimol/B2: 4.88547 | Sterimol/B3: 5.18235 | |||
| Sterimol/B4: 5.87873 | Sterimol/L: 18.6475 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 635.167 | Positive charged surface: 417.783 | Negative charged surface: 217.384 | Volume: 362.375 | |||
| Hydrophobic surface: 585.432 | Hydrophilic surface: 49.735 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
