Type: Neutral
Formula: C20H22N6O3S
SMILES: |
S(=O)(=O)(N1CC(CCC1)C(=O)Nc1ccccc1C)c1ccc(-n2nnnc2)cc1 |
InChI: |
InChI=1/C20H22N6O3S/c1-15-5-2-3-7-19(15)22-20(27)16-6-4-12-25(13-16)30(28,29)18-10-8-17(9-11-18)26-14-21-23-24-26/h2-3,5,7-11,14,16H,4,6,12-13H2,1H3,(H,22,27)/t16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 426.501 g/mol | logS: -3.43265 | SlogP: 2.01012 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0447863 | Sterimol/B1: 3.58835 | Sterimol/B2: 4.25332 | Sterimol/B3: 4.28398 |
Sterimol/B4: 6.2036 | Sterimol/L: 19.9365 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 674.472 | Positive charged surface: 356.376 | Negative charged surface: 284.114 | Volume: 380 |
Hydrophobic surface: 550.969 | Hydrophilic surface: 123.503 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |