Type: Neutral
Formula: C18H21ClN4O
SMILES: |
Clc1cc(ccc1)CNC(=O)C1CCCN(C1)c1nc(ccn1)C |
InChI: |
InChI=1/C18H21ClN4O/c1-13-7-8-20-18(22-13)23-9-3-5-15(12-23)17(24)21-11-14-4-2-6-16(19)10-14/h2,4,6-8,10,15H,3,5,9,11-12H2,1H3,(H,21,24)/t15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 344.846 g/mol | logS: -4.1139 | SlogP: 3.23762 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0645631 | Sterimol/B1: 3.17874 | Sterimol/B2: 3.98049 | Sterimol/B3: 4.19598 |
Sterimol/B4: 7.66256 | Sterimol/L: 16.8651 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 625.944 | Positive charged surface: 403.194 | Negative charged surface: 222.75 | Volume: 328 |
Hydrophobic surface: 556.296 | Hydrophilic surface: 69.648 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |