Type: Neutral
Formula: C23H24N4O2S
SMILES: |
s1cc(nc1NC(=O)c1ncccc1)-c1cc2CCN(c2cc1)C(=O)CC(C)(C)C |
InChI: |
InChI=1/C23H24N4O2S/c1-23(2,3)13-20(28)27-11-9-16-12-15(7-8-19(16)27)18-14-30-22(25-18)26-21(29)17-6-4-5-10-24-17/h4-8,10,12,14H,9,11,13H2,1-3H3,(H,25,26,29) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 420.537 g/mol | logS: -6.15096 | SlogP: 4.78267 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0136973 | Sterimol/B1: 2.3783 | Sterimol/B2: 4.584 | Sterimol/B3: 4.86917 |
Sterimol/B4: 5.23103 | Sterimol/L: 22.0671 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 704.044 | Positive charged surface: 442.604 | Negative charged surface: 261.44 | Volume: 397.875 |
Hydrophobic surface: 553.49 | Hydrophilic surface: 150.554 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |