Type: Neutral
Formula: C22H22N2O
SMILES: |
O=C(Nc1ccccc1CC)c1c2CCCCc2nc2c1cccc2 |
InChI: |
InChI=1/C22H22N2O/c1-2-15-9-3-6-12-18(15)24-22(25)21-16-10-4-7-13-19(16)23-20-14-8-5-11-17(20)21/h3-4,6-7,9-10,12-13H,2,5,8,11,14H2,1H3,(H,24,25) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 330.431 g/mol | logS: -5.70791 | SlogP: 4.92821 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.179349 | Sterimol/B1: 2.35008 | Sterimol/B2: 5.26447 | Sterimol/B3: 6.83882 |
Sterimol/B4: 6.98273 | Sterimol/L: 14.1435 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 584.105 | Positive charged surface: 360.415 | Negative charged surface: 218.74 | Volume: 334.875 |
Hydrophobic surface: 525.428 | Hydrophilic surface: 58.677 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |