Type: Neutral
Formula: C15H21NO6
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)C)C1OCc1ccccc1 |
InChI: |
InChI=1/C15H21NO6/c1-9(18)16-12-14(20)13(19)11(7-17)22-15(12)21-8-10-5-3-2-4-6-10/h2-6,11-15,17,19-20H,7-8H2,1H3,(H,16,18)/t11-,12+,13-,14-,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 311.334 g/mol | logS: -1.2456 | SlogP: -0.5867 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.151423 | Sterimol/B1: 2.68754 | Sterimol/B2: 3.25437 | Sterimol/B3: 5.41021 |
Sterimol/B4: 7.49653 | Sterimol/L: 15.1376 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 556.092 | Positive charged surface: 362.772 | Negative charged surface: 193.32 | Volume: 288.75 |
Hydrophobic surface: 372.941 | Hydrophilic surface: 183.151 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |