Type: Neutral
Formula: C10H12BrN5O5
SMILES: |
Brc1nc2c(n1C1OC(CO)C(O)C1O)N=C(NC2=O)N |
InChI: |
InChI=1/C10H12BrN5O5/c11-9-13-3-6(14-10(12)15-7(3)20)16(9)8-5(19)4(18)2(1-17)21-8/h2,4-5,8,17-19H,1H2,(H3,12,14,15,20)/t2-,4-,5+,8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 362.14 g/mol | logS: -2.35779 | SlogP: -1.9578 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.114508 | Sterimol/B1: 3.18666 | Sterimol/B2: 4.49949 | Sterimol/B3: 4.69235 |
Sterimol/B4: 5.1913 | Sterimol/L: 13.3227 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 491.528 | Positive charged surface: 299.573 | Negative charged surface: 191.955 | Volume: 253.5 |
Hydrophobic surface: 164.528 | Hydrophilic surface: 327 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |