Type: Neutral
Formula: C13H18N4O3
SMILES: |
OC(=O)C(NC(=O)c1ccccc1)CCCNC(N)=N |
InChI: |
InChI=1/C13H18N4O3/c14-13(15)16-8-4-7-10(12(19)20)17-11(18)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2,(H,17,18)(H,19,20)(H4,14,15,16)/t10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 278.312 g/mol | logS: -2.25093 | SlogP: 0.13287 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.075321 | Sterimol/B1: 2.33449 | Sterimol/B2: 3.14139 | Sterimol/B3: 3.8822 |
Sterimol/B4: 8.93281 | Sterimol/L: 15.0891 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 538.43 | Positive charged surface: 335.5 | Negative charged surface: 202.93 | Volume: 263.75 |
Hydrophobic surface: 275.9 | Hydrophilic surface: 262.53 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |