Type: Neutral
Formula: C16H18BrN3O4
| SMILES: |
Brc1cc2c(NC(=O)C3N(CCC(NC(=O)COC)C3)C2=O)cc1 |
| InChI: |
InChI=1/C16H18BrN3O4/c1-24-8-14(21)18-10-4-5-20-13(7-10)15(22)19-12-3-2-9(17)6-11(12)16(20)23/h2-3,6,10,13H,4-5,7-8H2,1H3,(H,18,21)(H,19,22)/t10-,13-/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 396.241 g/mol | logS: -3.73393 | SlogP: 1.137 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.043631 | Sterimol/B1: 3.3663 | Sterimol/B2: 3.73944 | Sterimol/B3: 3.78275 |
| Sterimol/B4: 4.57142 | Sterimol/L: 19.3121 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 587.9 | Positive charged surface: 355.691 | Negative charged surface: 232.209 | Volume: 314.375 |
| Hydrophobic surface: 445.56 | Hydrophilic surface: 142.34 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 2 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |