Type: Neutral
Formula: C19H27NO3
SMILES: |
O(C)c1cc(c2c(C(O)C(CC2)C(C(=O)NC2CC2)C)c1C)C |
InChI: |
InChI=1/C19H27NO3/c1-10-9-16(23-4)12(3)17-14(10)7-8-15(18(17)21)11(2)19(22)20-13-5-6-13/h9,11,13,15,18,21H,5-8H2,1-4H3,(H,20,22)/t11-,15-,18+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 317.429 g/mol | logS: -3.42473 | SlogP: 2.91801 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0495248 | Sterimol/B1: 2.51165 | Sterimol/B2: 2.95072 | Sterimol/B3: 4.09892 |
Sterimol/B4: 7.3083 | Sterimol/L: 15.8682 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 585.79 | Positive charged surface: 422.079 | Negative charged surface: 163.712 | Volume: 327.375 |
Hydrophobic surface: 463.155 | Hydrophilic surface: 122.635 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |