Type: Neutral
Formula: C16H20N2O6
SMILES: |
O1C2C(OCC2O)C(NC(=O)Nc2cc(ccc2)C(OCC)=O)C1 |
InChI: |
InChI=1/C16H20N2O6/c1-2-22-15(20)9-4-3-5-10(6-9)17-16(21)18-11-7-23-14-12(19)8-24-13(11)14/h3-6,11-14,19H,2,7-8H2,1H3,(H2,17,18,21)/t11-,12+,13+,14+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 336.344 g/mol | logS: -2.51755 | SlogP: 0.5119 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0287592 | Sterimol/B1: 2.48171 | Sterimol/B2: 3.26645 | Sterimol/B3: 3.55336 |
Sterimol/B4: 7.57375 | Sterimol/L: 18.699 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 601.231 | Positive charged surface: 437.566 | Negative charged surface: 163.665 | Volume: 302.875 |
Hydrophobic surface: 402.057 | Hydrophilic surface: 199.174 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |