Type: Neutral
Formula: C10H15N3O5
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C(C)C(=NC1=O)N |
InChI: |
InChI=1/C10H15N3O5/c1-4-2-13(10(17)12-8(4)11)9-7(16)6(15)5(3-14)18-9/h2,5-7,9,14-16H,3H2,1H3,(H2,11,12,17)/t5-,6+,7+,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 257.246 g/mol | logS: -0.08936 | SlogP: -1.878 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0911168 | Sterimol/B1: 2.54411 | Sterimol/B2: 3.13461 | Sterimol/B3: 3.74865 |
Sterimol/B4: 6.571 | Sterimol/L: 12.6381 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 444.704 | Positive charged surface: 315.61 | Negative charged surface: 129.094 | Volume: 220.125 |
Hydrophobic surface: 199.051 | Hydrophilic surface: 245.653 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |