 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(n2c3ncnc(O)c3nc2)C([O-])C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C10H12N4O8P/c15-6-4(1-21-23(18,19)20)22-10(7(6)16)14-3-13-5-8(14)11-2-12-9(5)17/h2-4,6-7,10,15H,1H2,(H,11,12,17)(H2,18,19,20)/q-1/p-2/t4-,6-,7-,10-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=47.4844 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 345.184 g/mol | logS: -0.88199 | SlogP: -3.5401 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0803946 | Sterimol/B1: 2.4471 | Sterimol/B2: 4.00825 | Sterimol/B3: 4.86346 | |||
| Sterimol/B4: 5.02839 | Sterimol/L: 15.6623 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 514.822 | Positive charged surface: 250.917 | Negative charged surface: 263.905 | Volume: 248.25 | |||
| Hydrophobic surface: 140.481 | Hydrophilic surface: 374.341 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
