Type: Ionized
Formula: C8H4O9-4
SMILES: |
O1C(C(=O)[O-])C(C(=O)[O-])C(C(=O)[O-])C1C(=O)[O-] |
InChI: |
InChI=1/C8H8O9/c9-5(10)1-2(6(11)12)4(8(15)16)17-3(1)7(13)14/h1-4H,(H,9,10)(H,11,12)(H,13,14)(H,15,16)/p-4/t1-,2-,3-,4+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 244.111 g/mol | logS: -0.42014 | SlogP: -7.0142 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.259282 | Sterimol/B1: 3.21751 | Sterimol/B2: 3.28284 | Sterimol/B3: 3.57487 |
Sterimol/B4: 4.91973 | Sterimol/L: 9.86588 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 371.559 | Positive charged surface: 103.584 | Negative charged surface: 267.975 | Volume: 171.375 |
Hydrophobic surface: 47.1346 | Hydrophilic surface: 324.4244 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 0 | Hydrogen bond acceptors: 1 | Acid groups: 8 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|