 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(n2c3N=C(NC(=O)c3nc2)N)CC1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C10H14N5O7P/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(22-6)2-21-23(18,19)20/h3-6,16H,1-2H2,(H2,18,19,20)(H3,11,13,14,17)/p-2/t4-,5+,6+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=3.01682 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 345.208 g/mol | logS: -1.00059 | SlogP: -3.9083 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0652964 | Sterimol/B1: 2.53273 | Sterimol/B2: 3.24412 | Sterimol/B3: 4.33109 | |||
| Sterimol/B4: 6.05027 | Sterimol/L: 15.6228 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 528.718 | Positive charged surface: 293.268 | Negative charged surface: 235.45 | Volume: 257.75 | |||
| Hydrophobic surface: 150.048 | Hydrophilic surface: 378.67 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
