Drugs present in MMsINC which are similar to the molecule MMscode: MMs02229003
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725570 | Clc1cc(Cl)cc2c1cc(c1c2cc(cc1)C(F)(F)F)C(O)CCN(CCCC)CCCC | 0.91 |
MMs01725613 | Clc1cc(Cl)cc2c1cc(c1c2cc(cc1)C(F)(F)F)C(O)CCN(CCCC)CCCC | 0.91 |
MMs01725069 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.73 |
MMs01725071 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.73 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |