Drugs present in MMsINC which are similar to the molecule MMscode: MMs00293970
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724766![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.79 |
MMs01724747![]() | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.74 |
MMs01725112![]() | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.74 |
MMs01725150![]() | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.71 |
MMs01724798![]() | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.71 |
MMs01724808![]() | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.71 |
MMs01725162![]() | Clc1cc2c(cc1)C(c1ncccc1CC2)=C1CCN(CC1)C(OCC)=O | 0.70 |









