Drugs present in MMsINC which are similar to the molecule MMscode: MMs03414750
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724870 | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.83 |
MMs01724989 | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.83 |
MMs01724731 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.75 |
MMs01724951 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.75 |
MMs01725169 | Clc1ccc(OC(C(=O)NC(=O)NCN2CCOCC2)(C)C)cc1 | 0.74 |