Drugs present in MMsINC which are similar to the molecule MMscode: MMs03403649
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727179 | Clc1cc2c(NC(=O)CN3CC(OC23c2ccccc2)C)cc1 | 0.76 |
MMs01727180 | Clc1cc2c(NC(=O)CN3CC(OC23c2ccccc2)C)cc1 | 0.76 |
MMs01726777 | Clc1cc2c(N(CCO)C(=O)CN3CCOC23c2ccccc2F)cc1 | 0.71 |
MMs01726498 | Clc1ccccc1C12N(CC(=O)Nc3c1cc(Cl)cc3)COC2 | 0.71 |
MMs01726499 | Clc1ccccc1C12N(CC(=O)Nc3c1cc(Cl)cc3)COC2 | 0.71 |