Drugs present in MMsINC which are similar to the molecule MMscode: MMs03252245
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725154 | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.78 |
MMs01725409 | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.76 |
MMs01724759 | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.75 |
MMs01726742 | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.75 |
MMs01724797 | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.73 |
MMs01725805 | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.73 |
MMs01725376 | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.72 |
MMs01725387 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725386 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.71 |
MMs01725123 | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.70 |