Drugs present in MMsINC which are similar to the molecule MMscode: MMs02861917
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724947![]() | Clc1cc2c(Sc3c(C=C2OCCN(C)C)cccc3)cc1 | 0.88 |
MMs01725786![]() | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.82 |
MMs01724737![]() | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.82 |
MMs01726473![]() | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.73 |
MMs01725133![]() | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.73 |
MMs01724857![]() | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.73 |
MMs01725289![]() | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.73 |