Drugs present in MMsINC which are similar to the molecule MMscode: MMs02852597
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724737![]() | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.85 |
MMs01725786![]() | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.85 |
MMs01725133![]() | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.76 |
MMs01724857![]() | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.76 |
MMs01726473![]() | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.76 |
MMs01724727![]() | Brc1ccc(cc1)C(OCCN(C)C)c1ccccc1 | 0.73 |
MMs01725049![]() | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.71 |
MMs01725487![]() | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.71 |
MMs01725071![]() | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.71 |
MMs01725069![]() | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.71 |